C24H29N3O4S — CID 46578445
1-[3-(cyclopentylsulfamoyl)benzoyl]-N-phenylpiperidine-3-carboxamide (PubChem CID 46578445) has the molecular formula C24H29N3O4S and a molecular weight of 455.58 g/mol. Its IUPAC name is 1-[3-(cyclopentylsulfamoyl)benzoyl]-N-phenylpiperidine-3-carboxamide.
| Compound Name | 1-[3-(cyclopentylsulfamoyl)benzoyl]-N-phenylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 46578445 |
| Molecular Formula | C24H29N3O4S |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | 1-[3-(cyclopentylsulfamoyl)benzoyl]-N-phenylpiperidine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1)C1CCCN(C(=O)c2cccc(S(=O)(=O)NC3CCCC3)c2)C1 |
| InChI | InChI=1S/C24H29N3O4S/c28-23(25-20-10-2-1-3-11-20)19-9-7-15-27(17-19)24(29)18-8-6-14-22(16-18)32(30,31)26-21-12-4-5-13-21/h1-3,6,8,10-11,14,16,19,21,26H,4-5,7,9,12-13,15,17H2,(H,25,28) |
| InChIKey | PQESVUGNDWDFEF-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |