C17H22ClN3O3S — CID 119490977
3-[[3-[3-(methylamino)piperidine-1-carbonyl]phenyl]methyl]-1,3-thiazolidine-2,4-dione;hydrochloride (PubChem CID 119490977) has the molecular formula C17H22ClN3O3S and a molecular weight of 383.90 g/mol. Its IUPAC name is 3-[[3-[3-(methylamino)piperidine-1-carbonyl]phenyl]methyl]-1,3-thiazolidine-2,4-dione;hydrochloride.
| Compound Name | 3-[[3-[3-(methylamino)piperidine-1-carbonyl]phenyl]methyl]-1,3-thiazolidine-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 119490977 |
| Molecular Formula | C17H22ClN3O3S |
| Molecular Weight | 383.90 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 3-[[3-[3-(methylamino)piperidine-1-carbonyl]phenyl]methyl]-1,3-thiazolidine-2,4-dione;hydrochloride |
| SMILES | CNC1CCCN(C(=O)c2cccc(CN3C(=O)CSC3=O)c2)C1.Cl |
| InChI | InChI=1S/C17H21N3O3S.ClH/c1-18-14-6-3-7-19(10-14)16(22)13-5-2-4-12(8-13)9-20-15(21)11-24-17(20)23;/h2,4-5,8,14,18H,3,6-7,9-11H2,1H3;1H |
| InChIKey | UBXQAQNEYCDSDN-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.90 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|