C22H24ClN3O3 — CID 119562797
2-[[3-[4-(methylamino)piperidine-1-carbonyl]phenyl]methyl]isoindole-1,3-dione;hydrochloride (PubChem CID 119562797) has the molecular formula C22H24ClN3O3 and a molecular weight of 413.91 g/mol. Its IUPAC name is 2-[[3-[4-(methylamino)piperidine-1-carbonyl]phenyl]methyl]isoindole-1,3-dione;hydrochloride.
| Compound Name | 2-[[3-[4-(methylamino)piperidine-1-carbonyl]phenyl]methyl]isoindole-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 119562797 |
| Molecular Formula | C22H24ClN3O3 |
| Molecular Weight | 413.91 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 2-[[3-[4-(methylamino)piperidine-1-carbonyl]phenyl]methyl]isoindole-1,3-dione;hydrochloride |
| SMILES | CNC1CCN(C(=O)c2cccc(CN3C(=O)c4ccccc4C3=O)c2)CC1.Cl |
| InChI | InChI=1S/C22H23N3O3.ClH/c1-23-17-9-11-24(12-10-17)20(26)16-6-4-5-15(13-16)14-25-21(27)18-7-2-3-8-19(18)22(25)28;/h2-8,13,17,23H,9-12,14H2,1H3;1H |
| InChIKey | WHDDNRNNKOXYRK-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.91 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|