C27H32N4O4 — CID 55631626
2-[4-[3-[(1,3-dioxoisoindol-2-yl)methyl]benzoyl]-1,4-diazepan-1-yl]-N,N-diethylacetamide (PubChem CID 55631626) has the molecular formula C27H32N4O4 and a molecular weight of 476.58 g/mol. Its IUPAC name is 2-[4-[3-[(1,3-dioxoisoindol-2-yl)methyl]benzoyl]-1,4-diazepan-1-yl]-N,N-diethylacetamide.
| Compound Name | 2-[4-[3-[(1,3-dioxoisoindol-2-yl)methyl]benzoyl]-1,4-diazepan-1-yl]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 55631626 |
| Molecular Formula | C27H32N4O4 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | 2-[4-[3-[(1,3-dioxoisoindol-2-yl)methyl]benzoyl]-1,4-diazepan-1-yl]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CN1CCCN(C(=O)c2cccc(CN3C(=O)c4ccccc4C3=O)c2)CC1 |
| InChI | InChI=1S/C27H32N4O4/c1-3-29(4-2)24(32)19-28-13-8-14-30(16-15-28)25(33)21-10-7-9-20(17-21)18-31-26(34)22-11-5-6-12-23(22)27(31)35/h5-7,9-12,17H,3-4,8,13-16,18-19H2,1-2H3 |
| InChIKey | JAARBIPPSXLMDS-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|