C28H27N3O3 — CID 32912923
2-[[4-(4-benzyl-1,4-diazepane-1-carbonyl)phenyl]methyl]isoindole-1,3-dione (PubChem CID 32912923) has the molecular formula C28H27N3O3 and a molecular weight of 453.54 g/mol. Its IUPAC name is 2-[[4-(4-benzyl-1,4-diazepane-1-carbonyl)phenyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[4-(4-benzyl-1,4-diazepane-1-carbonyl)phenyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 32912923 |
| Molecular Formula | C28H27N3O3 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | 2-[[4-(4-benzyl-1,4-diazepane-1-carbonyl)phenyl]methyl]isoindole-1,3-dione |
| SMILES | O=C(c1ccc(CN2C(=O)c3ccccc3C2=O)cc1)N1CCCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C28H27N3O3/c32-26(30-16-6-15-29(17-18-30)19-21-7-2-1-3-8-21)23-13-11-22(12-14-23)20-31-27(33)24-9-4-5-10-25(24)28(31)34/h1-5,7-14H,6,15-20H2 |
| InChIKey | RHZCGBWZZMQMPC-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|