2-(4-benzyl-1,4-diazepan-1-yl)-2-oxoacetic acid

C14H18N2O3 — CID 141207482

IUPAC2-(4-benzyl-1,4-diazepan-1-yl)-2-oxoacetic acid
SMILESO=C(O)C(=O)N1CCCN(Cc2ccccc2)CC1
InChIInChI=1S/C14H18N2O3/c17-13(14(18)19)16-8-4-7-15(9-10-16)11-12-5-2-1-3-6-12/h1-3,5-6H,4,7-11H2,(H,18,19)
InChIKeyLAVLKVWYXTVIET-UHFFFAOYSA-N
MW262.31 g/mol
LogP0.81
Rot. Bonds2

About 2-(4-benzyl-1,4-diazepan-1-yl)-2-oxoacetic acid

2-(4-benzyl-1,4-diazepan-1-yl)-2-oxoacetic acid (PubChem CID 141207482) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is 2-(4-benzyl-1,4-diazepan-1-yl)-2-oxoacetic acid.

Molecular Properties

Compound Name2-(4-benzyl-1,4-diazepan-1-yl)-2-oxoacetic acid
PubChem CID141207482
Molecular FormulaC14H18N2O3
Molecular Weight262.31 g/mol
Exact Mass262.13
IUPAC Name2-(4-benzyl-1,4-diazepan-1-yl)-2-oxoacetic acid
SMILESO=C(O)C(=O)N1CCCN(Cc2ccccc2)CC1
InChIInChI=1S/C14H18N2O3/c17-13(14(18)19)16-8-4-7-15(9-10-16)11-12-5-2-1-3-6-12/h1-3,5-6H,4,7-11H2,(H,18,19)
InChIKeyLAVLKVWYXTVIET-UHFFFAOYSA-N
XLogP0.81
TPSA60.85 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500262.31
LogP ≤ 50.81
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze 2-(4-benzyl-1,4-diazepan-1-yl)-2-oxoacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4-benzyl-1,4-diazepan-1-yl)-2-oxoacetic acid?
The IUPAC name of 2-(4-benzyl-1,4-diazepan-1-yl)-2-oxoacetic acid (CID 141207482) is 2-(4-benzyl-1,4-diazepan-1-yl)-2-oxoacetic acid.
What is the SMILES notation for 2-(4-benzyl-1,4-diazepan-1-yl)-2-oxoacetic acid?
The canonical SMILES for 2-(4-benzyl-1,4-diazepan-1-yl)-2-oxoacetic acid is O=C(O)C(=O)N1CCCN(Cc2ccccc2)CC1.
What is the InChIKey of 2-(4-benzyl-1,4-diazepan-1-yl)-2-oxoacetic acid?
The InChIKey is LAVLKVWYXTVIET-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O3/c17-13(14(18)19)16-8-4-7-15(9-10-16)11-12-5-2-1-3-6-12/h1-3,5-6H,4,7-11H2,(H,18,19).
What are the key properties of 2-(4-benzyl-1,4-diazepan-1-yl)-2-oxoacetic acid?
2-(4-benzyl-1,4-diazepan-1-yl)-2-oxoacetic acid has a molecular weight of 262.31 g/mol, XLogP of 0.81, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-benzyl-1,4-diazepan-1-yl)-2-oxoacetic acid is sourced from PubChem (CID 141207482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).