C25H28ClN3O3 — CID 37016544
2-butyl-5-[4-[(4-chlorophenyl)methyl]-1,4-diazepane-1-carbonyl]isoindole-1,3-dione (PubChem CID 37016544) has the molecular formula C25H28ClN3O3 and a molecular weight of 453.97 g/mol. Its IUPAC name is 2-butyl-5-[4-[(4-chlorophenyl)methyl]-1,4-diazepane-1-carbonyl]isoindole-1,3-dione.
| Compound Name | 2-butyl-5-[4-[(4-chlorophenyl)methyl]-1,4-diazepane-1-carbonyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 37016544 |
| Molecular Formula | C25H28ClN3O3 |
| Molecular Weight | 453.97 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | 2-butyl-5-[4-[(4-chlorophenyl)methyl]-1,4-diazepane-1-carbonyl]isoindole-1,3-dione |
| SMILES | CCCCN1C(=O)c2ccc(C(=O)N3CCCN(Cc4ccc(Cl)cc4)CC3)cc2C1=O |
| InChI | InChI=1S/C25H28ClN3O3/c1-2-3-13-29-24(31)21-10-7-19(16-22(21)25(29)32)23(30)28-12-4-11-27(14-15-28)17-18-5-8-20(26)9-6-18/h5-10,16H,2-4,11-15,17H2,1H3 |
| InChIKey | CKTCFDRHXOHTDL-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.97 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|