C25H29N3O4 — CID 55918032
2-butyl-5-[4-(4-methoxyphenyl)-1,4-diazepane-1-carbonyl]isoindole-1,3-dione (PubChem CID 55918032) has the molecular formula C25H29N3O4 and a molecular weight of 435.52 g/mol. Its IUPAC name is 2-butyl-5-[4-(4-methoxyphenyl)-1,4-diazepane-1-carbonyl]isoindole-1,3-dione.
| Compound Name | 2-butyl-5-[4-(4-methoxyphenyl)-1,4-diazepane-1-carbonyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 55918032 |
| Molecular Formula | C25H29N3O4 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | 2-butyl-5-[4-(4-methoxyphenyl)-1,4-diazepane-1-carbonyl]isoindole-1,3-dione |
| SMILES | CCCCN1C(=O)c2ccc(C(=O)N3CCCN(c4ccc(OC)cc4)CC3)cc2C1=O |
| InChI | InChI=1S/C25H29N3O4/c1-3-4-14-28-24(30)21-11-6-18(17-22(21)25(28)31)23(29)27-13-5-12-26(15-16-27)19-7-9-20(32-2)10-8-19/h6-11,17H,3-5,12-16H2,1-2H3 |
| InChIKey | KKEZPFHHKMARJE-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|