C24H26N4O5 — CID 108545927
2-(3-methoxypropyl)-5-[4-(pyridine-4-carbonyl)-1,4-diazepane-1-carbonyl]isoindole-1,3-dione (PubChem CID 108545927) has the molecular formula C24H26N4O5 and a molecular weight of 450.50 g/mol. Its IUPAC name is 2-(3-methoxypropyl)-5-[4-(pyridine-4-carbonyl)-1,4-diazepane-1-carbonyl]isoindole-1,3-dione.
| Compound Name | 2-(3-methoxypropyl)-5-[4-(pyridine-4-carbonyl)-1,4-diazepane-1-carbonyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 108545927 |
| Molecular Formula | C24H26N4O5 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | 2-(3-methoxypropyl)-5-[4-(pyridine-4-carbonyl)-1,4-diazepane-1-carbonyl]isoindole-1,3-dione |
| SMILES | COCCCN1C(=O)c2ccc(C(=O)N3CCCN(C(=O)c4ccncc4)CC3)cc2C1=O |
| InChI | InChI=1S/C24H26N4O5/c1-33-15-3-12-28-23(31)19-5-4-18(16-20(19)24(28)32)22(30)27-11-2-10-26(13-14-27)21(29)17-6-8-25-9-7-17/h4-9,16H,2-3,10-15H2,1H3 |
| InChIKey | CXMGEDTZEPSLTO-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 100.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|