C25H25N5O4 — CID 108763941
2-(3-methoxypropyl)-5-(4-quinoxalin-2-ylpiperazine-1-carbonyl)isoindole-1,3-dione (PubChem CID 108763941) has the molecular formula C25H25N5O4 and a molecular weight of 459.51 g/mol. Its IUPAC name is 2-(3-methoxypropyl)-5-(4-quinoxalin-2-ylpiperazine-1-carbonyl)isoindole-1,3-dione.
| Compound Name | 2-(3-methoxypropyl)-5-(4-quinoxalin-2-ylpiperazine-1-carbonyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 108763941 |
| Molecular Formula | C25H25N5O4 |
| Molecular Weight | 459.51 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | 2-(3-methoxypropyl)-5-(4-quinoxalin-2-ylpiperazine-1-carbonyl)isoindole-1,3-dione |
| SMILES | COCCCN1C(=O)c2ccc(C(=O)N3CCN(c4cnc5ccccc5n4)CC3)cc2C1=O |
| InChI | InChI=1S/C25H25N5O4/c1-34-14-4-9-30-24(32)18-8-7-17(15-19(18)25(30)33)23(31)29-12-10-28(11-13-29)22-16-26-20-5-2-3-6-21(20)27-22/h2-3,5-8,15-16H,4,9-14H2,1H3 |
| InChIKey | YGYLIQDDLLTVID-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 95.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.51 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|