C19H21Cl2N3O5 — CID 108568345
5-[4-(2,2-dichloroacetyl)piperazine-1-carbonyl]-2-(3-methoxypropyl)isoindole-1,3-dione (PubChem CID 108568345) has the molecular formula C19H21Cl2N3O5 and a molecular weight of 442.30 g/mol. Its IUPAC name is 5-[4-(2,2-dichloroacetyl)piperazine-1-carbonyl]-2-(3-methoxypropyl)isoindole-1,3-dione.
| Compound Name | 5-[4-(2,2-dichloroacetyl)piperazine-1-carbonyl]-2-(3-methoxypropyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 108568345 |
| Molecular Formula | C19H21Cl2N3O5 |
| Molecular Weight | 442.30 g/mol |
| Exact Mass | 441.09 |
| IUPAC Name | 5-[4-(2,2-dichloroacetyl)piperazine-1-carbonyl]-2-(3-methoxypropyl)isoindole-1,3-dione |
| SMILES | COCCCN1C(=O)c2ccc(C(=O)N3CCN(C(=O)C(Cl)Cl)CC3)cc2C1=O |
| InChI | InChI=1S/C19H21Cl2N3O5/c1-29-10-2-5-24-17(26)13-4-3-12(11-14(13)18(24)27)16(25)22-6-8-23(9-7-22)19(28)15(20)21/h3-4,11,15H,2,5-10H2,1H3 |
| InChIKey | OYWRLIQLEZSYNB-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.30 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|