C22H27N3O6 — CID 108535074
2-(3-methoxypropyl)-5-[4-(oxolane-2-carbonyl)piperazine-1-carbonyl]isoindole-1,3-dione (PubChem CID 108535074) has the molecular formula C22H27N3O6 and a molecular weight of 429.47 g/mol. Its IUPAC name is 2-(3-methoxypropyl)-5-[4-(oxolane-2-carbonyl)piperazine-1-carbonyl]isoindole-1,3-dione.
| Compound Name | 2-(3-methoxypropyl)-5-[4-(oxolane-2-carbonyl)piperazine-1-carbonyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 108535074 |
| Molecular Formula | C22H27N3O6 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | 2-(3-methoxypropyl)-5-[4-(oxolane-2-carbonyl)piperazine-1-carbonyl]isoindole-1,3-dione |
| SMILES | COCCCN1C(=O)c2ccc(C(=O)N3CCN(C(=O)C4CCCO4)CC3)cc2C1=O |
| InChI | InChI=1S/C22H27N3O6/c1-30-12-3-7-25-20(27)16-6-5-15(14-17(16)21(25)28)19(26)23-8-10-24(11-9-23)22(29)18-4-2-13-31-18/h5-6,14,18H,2-4,7-13H2,1H3 |
| InChIKey | MITALEDHKOKTDY-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 96.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|