C23H27N4O4+ — CID 9226443
2-(3-methoxypropyl)-5-[4-(pyridin-4-ylmethyl)piperazin-4-ium-1-carbonyl]isoindole-1,3-dione (PubChem CID 9226443) has the molecular formula C23H27N4O4+ and a molecular weight of 423.49 g/mol. Its IUPAC name is 2-(3-methoxypropyl)-5-[4-(pyridin-4-ylmethyl)piperazin-4-ium-1-carbonyl]isoindole-1,3-dione.
| Compound Name | 2-(3-methoxypropyl)-5-[4-(pyridin-4-ylmethyl)piperazin-4-ium-1-carbonyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 9226443 |
| Molecular Formula | C23H27N4O4+ |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 2-(3-methoxypropyl)-5-[4-(pyridin-4-ylmethyl)piperazin-4-ium-1-carbonyl]isoindole-1,3-dione |
| SMILES | COCCCN1C(=O)c2ccc(C(=O)N3CC[NH+](Cc4ccncc4)CC3)cc2C1=O |
| InChI | InChI=1S/C23H26N4O4/c1-31-14-2-9-27-22(29)19-4-3-18(15-20(19)23(27)30)21(28)26-12-10-25(11-13-26)16-17-5-7-24-8-6-17/h3-8,15H,2,9-14,16H2,1H3/p+1 |
| InChIKey | MSPWWZJWUMKGCY-UHFFFAOYSA-O |
| XLogP | 0.25 |
| TPSA | 84.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|