C29H30N3O4+ — CID 172640834
5-[4-[(4-methoxyphenyl)methyl]piperazin-4-ium-1-carbonyl]-2-(2-phenylethyl)isoindole-1,3-dione (PubChem CID 172640834) has the molecular formula C29H30N3O4+ and a molecular weight of 484.58 g/mol. Its IUPAC name is 5-[4-[(4-methoxyphenyl)methyl]piperazin-4-ium-1-carbonyl]-2-(2-phenylethyl)isoindole-1,3-dione.
| Compound Name | 5-[4-[(4-methoxyphenyl)methyl]piperazin-4-ium-1-carbonyl]-2-(2-phenylethyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 172640834 |
| Molecular Formula | C29H30N3O4+ |
| Molecular Weight | 484.58 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | 5-[4-[(4-methoxyphenyl)methyl]piperazin-4-ium-1-carbonyl]-2-(2-phenylethyl)isoindole-1,3-dione |
| SMILES | COc1ccc(C[NH+]2CCN(C(=O)c3ccc4c(c3)C(=O)N(CCc3ccccc3)C4=O)CC2)cc1 |
| InChI | InChI=1S/C29H29N3O4/c1-36-24-10-7-22(8-11-24)20-30-15-17-31(18-16-30)27(33)23-9-12-25-26(19-23)29(35)32(28(25)34)14-13-21-5-3-2-4-6-21/h2-12,19H,13-18,20H2,1H3/p+1 |
| InChIKey | LMCKMMKMRIIJPS-UHFFFAOYSA-O |
| XLogP | 2.07 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.58 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|