C19H22FN2O2+ — CID 3348086
(2-fluorophenyl)-[4-[(4-methoxyphenyl)methyl]piperazin-4-ium-1-yl]methanone (PubChem CID 3348086) has the molecular formula C19H22FN2O2+ and a molecular weight of 329.40 g/mol. Its IUPAC name is (2-fluorophenyl)-[4-[(4-methoxyphenyl)methyl]piperazin-4-ium-1-yl]methanone.
| Compound Name | (2-fluorophenyl)-[4-[(4-methoxyphenyl)methyl]piperazin-4-ium-1-yl]methanone |
|---|---|
| PubChem CID | 3348086 |
| Molecular Formula | C19H22FN2O2+ |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | (2-fluorophenyl)-[4-[(4-methoxyphenyl)methyl]piperazin-4-ium-1-yl]methanone |
| SMILES | COc1ccc(C[NH+]2CCN(C(=O)c3ccccc3F)CC2)cc1 |
| InChI | InChI=1S/C19H21FN2O2/c1-24-16-8-6-15(7-9-16)14-21-10-12-22(13-11-21)19(23)17-4-2-3-5-18(17)20/h2-9H,10-14H2,1H3/p+1 |
| InChIKey | VFGMWLZEKCNTLP-UHFFFAOYSA-O |
| XLogP | 1.38 |
| TPSA | 33.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |