C19H21BrFN2O2+ — CID 4755378
[4-[(3-bromo-4-methoxyphenyl)methyl]piperazin-4-ium-1-yl]-(2-fluorophenyl)methanone (PubChem CID 4755378) has the molecular formula C19H21BrFN2O2+ and a molecular weight of 408.29 g/mol. Its IUPAC name is [4-[(3-bromo-4-methoxyphenyl)methyl]piperazin-4-ium-1-yl]-(2-fluorophenyl)methanone.
| Compound Name | [4-[(3-bromo-4-methoxyphenyl)methyl]piperazin-4-ium-1-yl]-(2-fluorophenyl)methanone |
|---|---|
| PubChem CID | 4755378 |
| Molecular Formula | C19H21BrFN2O2+ |
| Molecular Weight | 408.29 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | [4-[(3-bromo-4-methoxyphenyl)methyl]piperazin-4-ium-1-yl]-(2-fluorophenyl)methanone |
| SMILES | COc1ccc(C[NH+]2CCN(C(=O)c3ccccc3F)CC2)cc1Br |
| InChI | InChI=1S/C19H20BrFN2O2/c1-25-18-7-6-14(12-16(18)20)13-22-8-10-23(11-9-22)19(24)15-4-2-3-5-17(15)21/h2-7,12H,8-11,13H2,1H3/p+1 |
| InChIKey | TXBLBCFAFVSLPX-UHFFFAOYSA-O |
| XLogP | 2.14 |
| TPSA | 33.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.29 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |