C20H24BrN2O3+ — CID 4754584
1-[4-[(3-bromo-4-methoxyphenyl)methyl]piperazin-4-ium-1-yl]-2-phenoxyethanone (PubChem CID 4754584) has the molecular formula C20H24BrN2O3+ and a molecular weight of 420.33 g/mol. Its IUPAC name is 1-[4-[(3-bromo-4-methoxyphenyl)methyl]piperazin-4-ium-1-yl]-2-phenoxyethanone.
| Compound Name | 1-[4-[(3-bromo-4-methoxyphenyl)methyl]piperazin-4-ium-1-yl]-2-phenoxyethanone |
|---|---|
| PubChem CID | 4754584 |
| Molecular Formula | C20H24BrN2O3+ |
| Molecular Weight | 420.33 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | 1-[4-[(3-bromo-4-methoxyphenyl)methyl]piperazin-4-ium-1-yl]-2-phenoxyethanone |
| SMILES | COc1ccc(C[NH+]2CCN(C(=O)COc3ccccc3)CC2)cc1Br |
| InChI | InChI=1S/C20H23BrN2O3/c1-25-19-8-7-16(13-18(19)21)14-22-9-11-23(12-10-22)20(24)15-26-17-5-3-2-4-6-17/h2-8,13H,9-12,14-15H2,1H3/p+1 |
| InChIKey | DHCRBTVAIHCYSR-UHFFFAOYSA-O |
| XLogP | 1.76 |
| TPSA | 43.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.33 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |