C23H24FN2O2+ — CID 6982152
1-[4-[(4-fluorophenyl)methyl]piperazin-4-ium-1-yl]-2-naphthalen-2-yloxyethanone (PubChem CID 6982152) has the molecular formula C23H24FN2O2+ and a molecular weight of 379.46 g/mol. Its IUPAC name is 1-[4-[(4-fluorophenyl)methyl]piperazin-4-ium-1-yl]-2-naphthalen-2-yloxyethanone.
| Compound Name | 1-[4-[(4-fluorophenyl)methyl]piperazin-4-ium-1-yl]-2-naphthalen-2-yloxyethanone |
|---|---|
| PubChem CID | 6982152 |
| Molecular Formula | C23H24FN2O2+ |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 1-[4-[(4-fluorophenyl)methyl]piperazin-4-ium-1-yl]-2-naphthalen-2-yloxyethanone |
| SMILES | O=C(COc1ccc2ccccc2c1)N1CC[NH+](Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C23H23FN2O2/c24-21-8-5-18(6-9-21)16-25-11-13-26(14-12-25)23(27)17-28-22-10-7-19-3-1-2-4-20(19)15-22/h1-10,15H,11-14,16-17H2/p+1 |
| InChIKey | AGMHMHQXDAGPKW-UHFFFAOYSA-O |
| XLogP | 2.29 |
| TPSA | 33.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |