C24H32N3O3+ — CID 9209259
1-(azepan-1-yl)-2-[4-(2-naphthalen-2-yloxyacetyl)piperazin-1-ium-1-yl]ethanone (PubChem CID 9209259) has the molecular formula C24H32N3O3+ and a molecular weight of 410.54 g/mol. Its IUPAC name is 1-(azepan-1-yl)-2-[4-(2-naphthalen-2-yloxyacetyl)piperazin-1-ium-1-yl]ethanone.
| Compound Name | 1-(azepan-1-yl)-2-[4-(2-naphthalen-2-yloxyacetyl)piperazin-1-ium-1-yl]ethanone |
|---|---|
| PubChem CID | 9209259 |
| Molecular Formula | C24H32N3O3+ |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | 1-(azepan-1-yl)-2-[4-(2-naphthalen-2-yloxyacetyl)piperazin-1-ium-1-yl]ethanone |
| SMILES | O=C(COc1ccc2ccccc2c1)N1CC[NH+](CC(=O)N2CCCCCC2)CC1 |
| InChI | InChI=1S/C24H31N3O3/c28-23(26-11-5-1-2-6-12-26)18-25-13-15-27(16-14-25)24(29)19-30-22-10-9-20-7-3-4-8-21(20)17-22/h3-4,7-10,17H,1-2,5-6,11-16,18-19H2/p+1 |
| InChIKey | NHGPYJDOKJGIPF-UHFFFAOYSA-O |
| XLogP | 1.35 |
| TPSA | 54.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |