C21H28N3O4+ — CID 8541523
N-(2-methoxyethyl)-2-[4-(2-naphthalen-2-yloxyacetyl)piperazin-1-ium-1-yl]acetamide (PubChem CID 8541523) has the molecular formula C21H28N3O4+ and a molecular weight of 386.47 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-[4-(2-naphthalen-2-yloxyacetyl)piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-(2-methoxyethyl)-2-[4-(2-naphthalen-2-yloxyacetyl)piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 8541523 |
| Molecular Formula | C21H28N3O4+ |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | N-(2-methoxyethyl)-2-[4-(2-naphthalen-2-yloxyacetyl)piperazin-1-ium-1-yl]acetamide |
| SMILES | COCCNC(=O)C[NH+]1CCN(C(=O)COc2ccc3ccccc3c2)CC1 |
| InChI | InChI=1S/C21H27N3O4/c1-27-13-8-22-20(25)15-23-9-11-24(12-10-23)21(26)16-28-19-7-6-17-4-2-3-5-18(17)14-19/h2-7,14H,8-13,15-16H2,1H3,(H,22,25)/p+1 |
| InChIKey | KLJMHGODVSDUMS-UHFFFAOYSA-O |
| XLogP | -0.29 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|