C21H28N3O3+ — CID 8945117
N-(3-methoxypropyl)-2-[4-(naphthalene-2-carbonyl)piperazin-1-ium-1-yl]acetamide (PubChem CID 8945117) has the molecular formula C21H28N3O3+ and a molecular weight of 370.47 g/mol. Its IUPAC name is N-(3-methoxypropyl)-2-[4-(naphthalene-2-carbonyl)piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-(3-methoxypropyl)-2-[4-(naphthalene-2-carbonyl)piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 8945117 |
| Molecular Formula | C21H28N3O3+ |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | N-(3-methoxypropyl)-2-[4-(naphthalene-2-carbonyl)piperazin-1-ium-1-yl]acetamide |
| SMILES | COCCCNC(=O)C[NH+]1CCN(C(=O)c2ccc3ccccc3c2)CC1 |
| InChI | InChI=1S/C21H27N3O3/c1-27-14-4-9-22-20(25)16-23-10-12-24(13-11-23)21(26)19-8-7-17-5-2-3-6-18(17)15-19/h2-3,5-8,15H,4,9-14,16H2,1H3,(H,22,25)/p+1 |
| InChIKey | NURVISPNLOEIBQ-UHFFFAOYSA-O |
| XLogP | 0.33 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|