C18H26N4O5 — CID 8945123
N-(3-methoxypropyl)-2-[4-(3-methyl-4-nitrobenzoyl)piperazin-1-yl]acetamide (PubChem CID 8945123) has the molecular formula C18H26N4O5 and a molecular weight of 378.43 g/mol. Its IUPAC name is N-(3-methoxypropyl)-2-[4-(3-methyl-4-nitrobenzoyl)piperazin-1-yl]acetamide.
| Compound Name | N-(3-methoxypropyl)-2-[4-(3-methyl-4-nitrobenzoyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 8945123 |
| Molecular Formula | C18H26N4O5 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | N-(3-methoxypropyl)-2-[4-(3-methyl-4-nitrobenzoyl)piperazin-1-yl]acetamide |
| SMILES | COCCCNC(=O)CN1CCN(C(=O)c2ccc([N+](=O)[O-])c(C)c2)CC1 |
| InChI | InChI=1S/C18H26N4O5/c1-14-12-15(4-5-16(14)22(25)26)18(24)21-9-7-20(8-10-21)13-17(23)19-6-3-11-27-2/h4-5,12H,3,6-11,13H2,1-2H3,(H,19,23) |
| InChIKey | LXYUTMISKXJZDM-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 105.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|