C21H32N4O8 — CID 55466171
2-[4-[5-methoxy-4-(2-methoxyethoxy)-2-nitrobenzoyl]piperazin-1-yl]-N-(3-methoxypropyl)acetamide (PubChem CID 55466171) has the molecular formula C21H32N4O8 and a molecular weight of 468.51 g/mol. Its IUPAC name is 2-[4-[5-methoxy-4-(2-methoxyethoxy)-2-nitrobenzoyl]piperazin-1-yl]-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-[4-[5-methoxy-4-(2-methoxyethoxy)-2-nitrobenzoyl]piperazin-1-yl]-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 55466171 |
| Molecular Formula | C21H32N4O8 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | 2-[4-[5-methoxy-4-(2-methoxyethoxy)-2-nitrobenzoyl]piperazin-1-yl]-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)CN1CCN(C(=O)c2cc(OC)c(OCCOC)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C21H32N4O8/c1-30-10-4-5-22-20(26)15-23-6-8-24(9-7-23)21(27)16-13-18(32-3)19(33-12-11-31-2)14-17(16)25(28)29/h13-14H,4-12,15H2,1-3H3,(H,22,26) |
| InChIKey | ASUMIPWRFNXOLQ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 132.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|