C16H24ClN3O6 — CID 119484805
[3-(aminomethyl)pyrrolidin-1-yl]-[5-methoxy-4-(2-methoxyethoxy)-2-nitrophenyl]methanone;hydrochloride (PubChem CID 119484805) has the molecular formula C16H24ClN3O6 and a molecular weight of 389.84 g/mol. Its IUPAC name is [3-(aminomethyl)pyrrolidin-1-yl]-[5-methoxy-4-(2-methoxyethoxy)-2-nitrophenyl]methanone;hydrochloride.
| Compound Name | [3-(aminomethyl)pyrrolidin-1-yl]-[5-methoxy-4-(2-methoxyethoxy)-2-nitrophenyl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119484805 |
| Molecular Formula | C16H24ClN3O6 |
| Molecular Weight | 389.84 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | [3-(aminomethyl)pyrrolidin-1-yl]-[5-methoxy-4-(2-methoxyethoxy)-2-nitrophenyl]methanone;hydrochloride |
| SMILES | COCCOc1cc([N+](=O)[O-])c(C(=O)N2CCC(CN)C2)cc1OC.Cl |
| InChI | InChI=1S/C16H23N3O6.ClH/c1-23-5-6-25-15-8-13(19(21)22)12(7-14(15)24-2)16(20)18-4-3-11(9-17)10-18;/h7-8,11H,3-6,9-10,17H2,1-2H3;1H |
| InChIKey | OYHDGKUMVHJTIK-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 117.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.84 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|