C22H26N3O4+ — CID 9223118
methyl 3-[[2-(4-benzoylpiperazin-1-ium-1-yl)acetyl]amino]-4-methylbenzoate (PubChem CID 9223118) has the molecular formula C22H26N3O4+ and a molecular weight of 396.47 g/mol. Its IUPAC name is methyl 3-[[2-(4-benzoylpiperazin-1-ium-1-yl)acetyl]amino]-4-methylbenzoate.
| Compound Name | methyl 3-[[2-(4-benzoylpiperazin-1-ium-1-yl)acetyl]amino]-4-methylbenzoate |
|---|---|
| PubChem CID | 9223118 |
| Molecular Formula | C22H26N3O4+ |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | methyl 3-[[2-(4-benzoylpiperazin-1-ium-1-yl)acetyl]amino]-4-methylbenzoate |
| SMILES | COC(=O)c1ccc(C)c(NC(=O)C[NH+]2CCN(C(=O)c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C22H25N3O4/c1-16-8-9-18(22(28)29-2)14-19(16)23-20(26)15-24-10-12-25(13-11-24)21(27)17-6-4-3-5-7-17/h3-9,14H,10-13,15H2,1-2H3,(H,23,26)/p+1 |
| InChIKey | VOBMMJKPDONMPL-UHFFFAOYSA-O |
| XLogP | 0.76 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |