C19H21ClN3O2+ — CID 9223569
2-(4-benzoylpiperazin-1-ium-1-yl)-N-(4-chlorophenyl)acetamide (PubChem CID 9223569) has the molecular formula C19H21ClN3O2+ and a molecular weight of 358.85 g/mol. Its IUPAC name is 2-(4-benzoylpiperazin-1-ium-1-yl)-N-(4-chlorophenyl)acetamide.
| Compound Name | 2-(4-benzoylpiperazin-1-ium-1-yl)-N-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 9223569 |
| Molecular Formula | C19H21ClN3O2+ |
| Molecular Weight | 358.85 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 2-(4-benzoylpiperazin-1-ium-1-yl)-N-(4-chlorophenyl)acetamide |
| SMILES | O=C(C[NH+]1CCN(C(=O)c2ccccc2)CC1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H20ClN3O2/c20-16-6-8-17(9-7-16)21-18(24)14-22-10-12-23(13-11-22)19(25)15-4-2-1-3-5-15/h1-9H,10-14H2,(H,21,24)/p+1 |
| InChIKey | SKZRBXUYNFDSAD-UHFFFAOYSA-O |
| XLogP | 1.32 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.85 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |