C19H20ClN4O4+ — CID 9223655
2-(4-benzoylpiperazin-1-ium-1-yl)-N-(5-chloro-2-nitrophenyl)acetamide (PubChem CID 9223655) has the molecular formula C19H20ClN4O4+ and a molecular weight of 403.85 g/mol. Its IUPAC name is 2-(4-benzoylpiperazin-1-ium-1-yl)-N-(5-chloro-2-nitrophenyl)acetamide.
| Compound Name | 2-(4-benzoylpiperazin-1-ium-1-yl)-N-(5-chloro-2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 9223655 |
| Molecular Formula | C19H20ClN4O4+ |
| Molecular Weight | 403.85 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 2-(4-benzoylpiperazin-1-ium-1-yl)-N-(5-chloro-2-nitrophenyl)acetamide |
| SMILES | O=C(C[NH+]1CCN(C(=O)c2ccccc2)CC1)Nc1cc(Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H19ClN4O4/c20-15-6-7-17(24(27)28)16(12-15)21-18(25)13-22-8-10-23(11-9-22)19(26)14-4-2-1-3-5-14/h1-7,12H,8-11,13H2,(H,21,25)/p+1 |
| InChIKey | DIANPMLBGLHONX-UHFFFAOYSA-O |
| XLogP | 1.23 |
| TPSA | 96.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.85 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|