C20H24ClN4O3+ — CID 9338756
2-[4-(4-chloro-2-nitrophenyl)piperazin-1-ium-1-yl]-N-(2,3-dimethylphenyl)acetamide (PubChem CID 9338756) has the molecular formula C20H24ClN4O3+ and a molecular weight of 403.89 g/mol. Its IUPAC name is 2-[4-(4-chloro-2-nitrophenyl)piperazin-1-ium-1-yl]-N-(2,3-dimethylphenyl)acetamide.
| Compound Name | 2-[4-(4-chloro-2-nitrophenyl)piperazin-1-ium-1-yl]-N-(2,3-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 9338756 |
| Molecular Formula | C20H24ClN4O3+ |
| Molecular Weight | 403.89 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 2-[4-(4-chloro-2-nitrophenyl)piperazin-1-ium-1-yl]-N-(2,3-dimethylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)C[NH+]2CCN(c3ccc(Cl)cc3[N+](=O)[O-])CC2)c1C |
| InChI | InChI=1S/C20H23ClN4O3/c1-14-4-3-5-17(15(14)2)22-20(26)13-23-8-10-24(11-9-23)18-7-6-16(21)12-19(18)25(27)28/h3-7,12H,8-11,13H2,1-2H3,(H,22,26)/p+1 |
| InChIKey | FTZZHHRFEUWZDG-UHFFFAOYSA-O |
| XLogP | 2.21 |
| TPSA | 79.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.89 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|