C20H25ClN3OS+ — CID 8591327
2-[4-(5-chloro-2-methylphenyl)piperazin-1-ium-1-yl]-N-(2-methylsulfanylphenyl)acetamide (PubChem CID 8591327) has the molecular formula C20H25ClN3OS+ and a molecular weight of 390.96 g/mol. Its IUPAC name is 2-[4-(5-chloro-2-methylphenyl)piperazin-1-ium-1-yl]-N-(2-methylsulfanylphenyl)acetamide.
| Compound Name | 2-[4-(5-chloro-2-methylphenyl)piperazin-1-ium-1-yl]-N-(2-methylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 8591327 |
| Molecular Formula | C20H25ClN3OS+ |
| Molecular Weight | 390.96 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 2-[4-(5-chloro-2-methylphenyl)piperazin-1-ium-1-yl]-N-(2-methylsulfanylphenyl)acetamide |
| SMILES | CSc1ccccc1NC(=O)C[NH+]1CCN(c2cc(Cl)ccc2C)CC1 |
| InChI | InChI=1S/C20H24ClN3OS/c1-15-7-8-16(21)13-18(15)24-11-9-23(10-12-24)14-20(25)22-17-5-3-4-6-19(17)26-2/h3-8,13H,9-12,14H2,1-2H3,(H,22,25)/p+1 |
| InChIKey | XVUSYSBULCKXCR-UHFFFAOYSA-O |
| XLogP | 2.71 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.96 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |