C24H25ClN3OS+ — CID 2124469
2-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]-N-(2-phenylsulfanylphenyl)acetamide (PubChem CID 2124469) has the molecular formula C24H25ClN3OS+ and a molecular weight of 439.00 g/mol. Its IUPAC name is 2-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]-N-(2-phenylsulfanylphenyl)acetamide.
| Compound Name | 2-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]-N-(2-phenylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 2124469 |
| Molecular Formula | C24H25ClN3OS+ |
| Molecular Weight | 439.00 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | 2-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]-N-(2-phenylsulfanylphenyl)acetamide |
| SMILES | O=C(C[NH+]1CCN(c2cccc(Cl)c2)CC1)Nc1ccccc1Sc1ccccc1 |
| InChI | InChI=1S/C24H24ClN3OS/c25-19-7-6-8-20(17-19)28-15-13-27(14-16-28)18-24(29)26-22-11-4-5-12-23(22)30-21-9-2-1-3-10-21/h1-12,17H,13-16,18H2,(H,26,29)/p+1 |
| InChIKey | OOGYXBUYDJFBBF-UHFFFAOYSA-O |
| XLogP | 3.83 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.00 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |