C25H28N3OS+ — CID 9027350
N-(2-benzylsulfanylphenyl)-2-(4-phenylpiperazin-1-ium-1-yl)acetamide (PubChem CID 9027350) has the molecular formula C25H28N3OS+ and a molecular weight of 418.59 g/mol. Its IUPAC name is N-(2-benzylsulfanylphenyl)-2-(4-phenylpiperazin-1-ium-1-yl)acetamide.
| Compound Name | N-(2-benzylsulfanylphenyl)-2-(4-phenylpiperazin-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 9027350 |
| Molecular Formula | C25H28N3OS+ |
| Molecular Weight | 418.59 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | N-(2-benzylsulfanylphenyl)-2-(4-phenylpiperazin-1-ium-1-yl)acetamide |
| SMILES | O=C(C[NH+]1CCN(c2ccccc2)CC1)Nc1ccccc1SCc1ccccc1 |
| InChI | InChI=1S/C25H27N3OS/c29-25(19-27-15-17-28(18-16-27)22-11-5-2-6-12-22)26-23-13-7-8-14-24(23)30-20-21-9-3-1-4-10-21/h1-14H,15-20H2,(H,26,29)/p+1 |
| InChIKey | JONLMPVZJHTMOY-UHFFFAOYSA-O |
| XLogP | 3.32 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.59 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |