C24H26N3O+ — CID 2653965
N-(2-phenylphenyl)-2-(4-phenylpiperazin-1-ium-1-yl)acetamide (PubChem CID 2653965) has the molecular formula C24H26N3O+ and a molecular weight of 372.49 g/mol. Its IUPAC name is N-(2-phenylphenyl)-2-(4-phenylpiperazin-1-ium-1-yl)acetamide.
| Compound Name | N-(2-phenylphenyl)-2-(4-phenylpiperazin-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 2653965 |
| Molecular Formula | C24H26N3O+ |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | N-(2-phenylphenyl)-2-(4-phenylpiperazin-1-ium-1-yl)acetamide |
| SMILES | O=C(C[NH+]1CCN(c2ccccc2)CC1)Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C24H25N3O/c28-24(19-26-15-17-27(18-16-26)21-11-5-2-6-12-21)25-23-14-8-7-13-22(23)20-9-3-1-4-10-20/h1-14H,15-19H2,(H,25,28)/p+1 |
| InChIKey | KOKODDUAMNGMHD-UHFFFAOYSA-O |
| XLogP | 2.70 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |