C22H30N3O+ — CID 6985943
N-(2,6-diethylphenyl)-2-(4-phenylpiperazin-1-ium-1-yl)acetamide (PubChem CID 6985943) has the molecular formula C22H30N3O+ and a molecular weight of 352.50 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)-2-(4-phenylpiperazin-1-ium-1-yl)acetamide.
| Compound Name | N-(2,6-diethylphenyl)-2-(4-phenylpiperazin-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 6985943 |
| Molecular Formula | C22H30N3O+ |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | N-(2,6-diethylphenyl)-2-(4-phenylpiperazin-1-ium-1-yl)acetamide |
| SMILES | CCc1cccc(CC)c1NC(=O)C[NH+]1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C22H29N3O/c1-3-18-9-8-10-19(4-2)22(18)23-21(26)17-24-13-15-25(16-14-24)20-11-6-5-7-12-20/h5-12H,3-4,13-17H2,1-2H3,(H,23,26)/p+1 |
| InChIKey | REIFLIHGHWNUAA-UHFFFAOYSA-O |
| XLogP | 2.15 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |