C19H21N4O+ — CID 8688681
N-(3-cyanophenyl)-2-(4-phenylpiperazin-1-ium-1-yl)acetamide (PubChem CID 8688681) has the molecular formula C19H21N4O+ and a molecular weight of 321.40 g/mol. Its IUPAC name is N-(3-cyanophenyl)-2-(4-phenylpiperazin-1-ium-1-yl)acetamide.
| Compound Name | N-(3-cyanophenyl)-2-(4-phenylpiperazin-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 8688681 |
| Molecular Formula | C19H21N4O+ |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | N-(3-cyanophenyl)-2-(4-phenylpiperazin-1-ium-1-yl)acetamide |
| SMILES | N#Cc1cccc(NC(=O)C[NH+]2CCN(c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C19H20N4O/c20-14-16-5-4-6-17(13-16)21-19(24)15-22-9-11-23(12-10-22)18-7-2-1-3-8-18/h1-8,13H,9-12,15H2,(H,21,24)/p+1 |
| InChIKey | LRRNAYMNVUPBKR-UHFFFAOYSA-O |
| XLogP | 0.90 |
| TPSA | 60.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |