C18H21BrN3O2+ — CID 2161088
N-(3-bromophenyl)-2-[4-(4-hydroxyphenyl)piperazin-1-ium-1-yl]acetamide (PubChem CID 2161088) has the molecular formula C18H21BrN3O2+ and a molecular weight of 391.29 g/mol. Its IUPAC name is N-(3-bromophenyl)-2-[4-(4-hydroxyphenyl)piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-(3-bromophenyl)-2-[4-(4-hydroxyphenyl)piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 2161088 |
| Molecular Formula | C18H21BrN3O2+ |
| Molecular Weight | 391.29 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | N-(3-bromophenyl)-2-[4-(4-hydroxyphenyl)piperazin-1-ium-1-yl]acetamide |
| SMILES | O=C(C[NH+]1CCN(c2ccc(O)cc2)CC1)Nc1cccc(Br)c1 |
| InChI | InChI=1S/C18H20BrN3O2/c19-14-2-1-3-15(12-14)20-18(24)13-21-8-10-22(11-9-21)16-4-6-17(23)7-5-16/h1-7,12,23H,8-11,13H2,(H,20,24)/p+1 |
| InChIKey | MJLIXYNLMQPMEB-UHFFFAOYSA-O |
| XLogP | 1.50 |
| TPSA | 57.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.29 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |