C21H26N3O2S+ — CID 8005789
2-[4-(4-acetylphenyl)piperazin-1-ium-1-yl]-N-(3-methylsulfanylphenyl)acetamide (PubChem CID 8005789) has the molecular formula C21H26N3O2S+ and a molecular weight of 384.53 g/mol. Its IUPAC name is 2-[4-(4-acetylphenyl)piperazin-1-ium-1-yl]-N-(3-methylsulfanylphenyl)acetamide.
| Compound Name | 2-[4-(4-acetylphenyl)piperazin-1-ium-1-yl]-N-(3-methylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 8005789 |
| Molecular Formula | C21H26N3O2S+ |
| Molecular Weight | 384.53 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 2-[4-(4-acetylphenyl)piperazin-1-ium-1-yl]-N-(3-methylsulfanylphenyl)acetamide |
| SMILES | CSc1cccc(NC(=O)C[NH+]2CCN(c3ccc(C(C)=O)cc3)CC2)c1 |
| InChI | InChI=1S/C21H25N3O2S/c1-16(25)17-6-8-19(9-7-17)24-12-10-23(11-13-24)15-21(26)22-18-4-3-5-20(14-18)27-2/h3-9,14H,10-13,15H2,1-2H3,(H,22,26)/p+1 |
| InChIKey | CUSBOPBLGCDKPK-UHFFFAOYSA-O |
| XLogP | 1.95 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.53 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |