C22H28N3O2+ — CID 2656205
2-[4-(4-acetylphenyl)piperazin-1-ium-1-yl]-N-(3,4-dimethylphenyl)acetamide (PubChem CID 2656205) has the molecular formula C22H28N3O2+ and a molecular weight of 366.49 g/mol. Its IUPAC name is 2-[4-(4-acetylphenyl)piperazin-1-ium-1-yl]-N-(3,4-dimethylphenyl)acetamide.
| Compound Name | 2-[4-(4-acetylphenyl)piperazin-1-ium-1-yl]-N-(3,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 2656205 |
| Molecular Formula | C22H28N3O2+ |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | 2-[4-(4-acetylphenyl)piperazin-1-ium-1-yl]-N-(3,4-dimethylphenyl)acetamide |
| SMILES | CC(=O)c1ccc(N2CC[NH+](CC(=O)Nc3ccc(C)c(C)c3)CC2)cc1 |
| InChI | InChI=1S/C22H27N3O2/c1-16-4-7-20(14-17(16)2)23-22(27)15-24-10-12-25(13-11-24)21-8-5-19(6-9-21)18(3)26/h4-9,14H,10-13,15H2,1-3H3,(H,23,27)/p+1 |
| InChIKey | BKNHDSGCHYEPJH-UHFFFAOYSA-O |
| XLogP | 1.85 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |