C20H22F2N3O2+ — CID 2656227
2-[4-(4-acetylphenyl)piperazin-1-ium-1-yl]-N-(2,4-difluorophenyl)acetamide (PubChem CID 2656227) has the molecular formula C20H22F2N3O2+ and a molecular weight of 374.41 g/mol. Its IUPAC name is 2-[4-(4-acetylphenyl)piperazin-1-ium-1-yl]-N-(2,4-difluorophenyl)acetamide.
| Compound Name | 2-[4-(4-acetylphenyl)piperazin-1-ium-1-yl]-N-(2,4-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 2656227 |
| Molecular Formula | C20H22F2N3O2+ |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 2-[4-(4-acetylphenyl)piperazin-1-ium-1-yl]-N-(2,4-difluorophenyl)acetamide |
| SMILES | CC(=O)c1ccc(N2CC[NH+](CC(=O)Nc3ccc(F)cc3F)CC2)cc1 |
| InChI | InChI=1S/C20H21F2N3O2/c1-14(26)15-2-5-17(6-3-15)25-10-8-24(9-11-25)13-20(27)23-19-7-4-16(21)12-18(19)22/h2-7,12H,8-11,13H2,1H3,(H,23,27)/p+1 |
| InChIKey | WOTZPDQBSWEWNI-UHFFFAOYSA-O |
| XLogP | 1.51 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |