C22H27FN3O2+ — CID 7830382
2-[4-(4-acetylphenyl)piperazin-1-ium-1-yl]-N-[2-(4-fluorophenyl)ethyl]acetamide (PubChem CID 7830382) has the molecular formula C22H27FN3O2+ and a molecular weight of 384.48 g/mol. Its IUPAC name is 2-[4-(4-acetylphenyl)piperazin-1-ium-1-yl]-N-[2-(4-fluorophenyl)ethyl]acetamide.
| Compound Name | 2-[4-(4-acetylphenyl)piperazin-1-ium-1-yl]-N-[2-(4-fluorophenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 7830382 |
| Molecular Formula | C22H27FN3O2+ |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | 2-[4-(4-acetylphenyl)piperazin-1-ium-1-yl]-N-[2-(4-fluorophenyl)ethyl]acetamide |
| SMILES | CC(=O)c1ccc(N2CC[NH+](CC(=O)NCCc3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C22H26FN3O2/c1-17(27)19-4-8-21(9-5-19)26-14-12-25(13-15-26)16-22(28)24-11-10-18-2-6-20(23)7-3-18/h2-9H,10-16H2,1H3,(H,24,28)/p+1 |
| InChIKey | MCQIWKIPRSLASG-UHFFFAOYSA-O |
| XLogP | 1.09 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |