C21H27FN3O+ — CID 8704079
2-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]-N-[(2S)-2-phenylpropyl]acetamide (PubChem CID 8704079) has the molecular formula C21H27FN3O+ and a molecular weight of 356.47 g/mol. Its IUPAC name is 2-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]-N-[(2S)-2-phenylpropyl]acetamide.
| Compound Name | 2-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]-N-[(2S)-2-phenylpropyl]acetamide |
|---|---|
| PubChem CID | 8704079 |
| Molecular Formula | C21H27FN3O+ |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | 2-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]-N-[(2S)-2-phenylpropyl]acetamide |
| SMILES | C[C@H](CNC(=O)C[NH+]1CCN(c2ccc(F)cc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C21H26FN3O/c1-17(18-5-3-2-4-6-18)15-23-21(26)16-24-11-13-25(14-12-24)20-9-7-19(22)8-10-20/h2-10,17H,11-16H2,1H3,(H,23,26)/p+1/t17-/m1/s1 |
| InChIKey | ADFMALJWPZZCJO-QGZVFWFLSA-O |
| XLogP | 1.45 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |