C19H22FN4O2+ — CID 8703830
N'-[2-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]acetyl]benzohydrazide (PubChem CID 8703830) has the molecular formula C19H22FN4O2+ and a molecular weight of 357.41 g/mol. Its IUPAC name is N'-[2-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]acetyl]benzohydrazide.
| Compound Name | N'-[2-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 8703830 |
| Molecular Formula | C19H22FN4O2+ |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | N'-[2-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]acetyl]benzohydrazide |
| SMILES | O=C(C[NH+]1CCN(c2ccc(F)cc2)CC1)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H21FN4O2/c20-16-6-8-17(9-7-16)24-12-10-23(11-13-24)14-18(25)21-22-19(26)15-4-2-1-3-5-15/h1-9H,10-14H2,(H,21,25)(H,22,26)/p+1 |
| InChIKey | JCNIKYGFWQLLIB-UHFFFAOYSA-O |
| XLogP | -0.01 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|