C19H22F3N5O2+2 — CID 9288222
N'-[2-[4-[5-(trifluoromethyl)pyridin-1-ium-2-yl]piperazin-1-ium-1-yl]acetyl]benzohydrazide (PubChem CID 9288222) has the molecular formula C19H22F3N5O2+2 and a molecular weight of 409.41 g/mol. Its IUPAC name is N'-[2-[4-[5-(trifluoromethyl)pyridin-1-ium-2-yl]piperazin-1-ium-1-yl]acetyl]benzohydrazide.
| Compound Name | N'-[2-[4-[5-(trifluoromethyl)pyridin-1-ium-2-yl]piperazin-1-ium-1-yl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 9288222 |
| Molecular Formula | C19H22F3N5O2+2 |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | N'-[2-[4-[5-(trifluoromethyl)pyridin-1-ium-2-yl]piperazin-1-ium-1-yl]acetyl]benzohydrazide |
| SMILES | O=C(C[NH+]1CCN(c2ccc(C(F)(F)F)c[nH+]2)CC1)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H20F3N5O2/c20-19(21,22)15-6-7-16(23-12-15)27-10-8-26(9-11-27)13-17(28)24-25-18(29)14-4-2-1-3-5-14/h1-7,12H,8-11,13H2,(H,24,28)(H,25,29)/p+2 |
| InChIKey | HVPKTRYUDUETLU-UHFFFAOYSA-P |
| XLogP | -0.31 |
| TPSA | 80.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|