C19H22F3N3O2+2 — CID 9288374
methyl 4-[[4-[5-(trifluoromethyl)pyridin-1-ium-2-yl]piperazin-1-ium-1-yl]methyl]benzoate (PubChem CID 9288374) has the molecular formula C19H22F3N3O2+2 and a molecular weight of 381.40 g/mol. Its IUPAC name is methyl 4-[[4-[5-(trifluoromethyl)pyridin-1-ium-2-yl]piperazin-1-ium-1-yl]methyl]benzoate.
| Compound Name | methyl 4-[[4-[5-(trifluoromethyl)pyridin-1-ium-2-yl]piperazin-1-ium-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 9288374 |
| Molecular Formula | C19H22F3N3O2+2 |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | methyl 4-[[4-[5-(trifluoromethyl)pyridin-1-ium-2-yl]piperazin-1-ium-1-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccc(C[NH+]2CCN(c3ccc(C(F)(F)F)c[nH+]3)CC2)cc1 |
| InChI | InChI=1S/C19H20F3N3O2/c1-27-18(26)15-4-2-14(3-5-15)13-24-8-10-25(11-9-24)17-7-6-16(12-23-17)19(20,21)22/h2-7,12H,8-11,13H2,1H3/p+2 |
| InChIKey | LIMASZNQZNFENA-UHFFFAOYSA-P |
| XLogP | 1.21 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |