C21H22F3N3O3+2 — CID 9288237
7-methoxy-4-[[4-[5-(trifluoromethyl)pyridin-1-ium-2-yl]piperazin-1-ium-1-yl]methyl]chromen-2-one (PubChem CID 9288237) has the molecular formula C21H22F3N3O3+2 and a molecular weight of 421.42 g/mol. Its IUPAC name is 7-methoxy-4-[[4-[5-(trifluoromethyl)pyridin-1-ium-2-yl]piperazin-1-ium-1-yl]methyl]chromen-2-one.
| Compound Name | 7-methoxy-4-[[4-[5-(trifluoromethyl)pyridin-1-ium-2-yl]piperazin-1-ium-1-yl]methyl]chromen-2-one |
|---|---|
| PubChem CID | 9288237 |
| Molecular Formula | C21H22F3N3O3+2 |
| Molecular Weight | 421.42 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 7-methoxy-4-[[4-[5-(trifluoromethyl)pyridin-1-ium-2-yl]piperazin-1-ium-1-yl]methyl]chromen-2-one |
| SMILES | COc1ccc2c(C[NH+]3CCN(c4ccc(C(F)(F)F)c[nH+]4)CC3)cc(=O)oc2c1 |
| InChI | InChI=1S/C21H20F3N3O3/c1-29-16-3-4-17-14(10-20(28)30-18(17)11-16)13-26-6-8-27(9-7-26)19-5-2-15(12-25-19)21(22,23)24/h2-5,10-12H,6-9,13H2,1H3/p+2 |
| InChIKey | CUQBXLDKSZVFQE-UHFFFAOYSA-P |
| XLogP | 1.54 |
| TPSA | 61.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.42 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|