C25H31N2O3+ — CID 2655455
4-[[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]methyl]-7-methyl-6-propan-2-ylchromen-2-one (PubChem CID 2655455) has the molecular formula C25H31N2O3+ and a molecular weight of 407.53 g/mol. Its IUPAC name is 4-[[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]methyl]-7-methyl-6-propan-2-ylchromen-2-one.
| Compound Name | 4-[[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]methyl]-7-methyl-6-propan-2-ylchromen-2-one |
|---|---|
| PubChem CID | 2655455 |
| Molecular Formula | C25H31N2O3+ |
| Molecular Weight | 407.53 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | 4-[[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]methyl]-7-methyl-6-propan-2-ylchromen-2-one |
| SMILES | COc1ccc(N2CC[NH+](Cc3cc(=O)oc4cc(C)c(C(C)C)cc34)CC2)cc1 |
| InChI | InChI=1S/C25H30N2O3/c1-17(2)22-15-23-19(14-25(28)30-24(23)13-18(22)3)16-26-9-11-27(12-10-26)20-5-7-21(29-4)8-6-20/h5-8,13-15,17H,9-12,16H2,1-4H3/p+1 |
| InChIKey | CGHZOOYGPKULLK-UHFFFAOYSA-O |
| XLogP | 3.14 |
| TPSA | 47.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.53 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|