C16H20NO4+ — CID 9339880
4-[(4-hydroxypiperidin-1-ium-1-yl)methyl]-7-methoxychromen-2-one (PubChem CID 9339880) has the molecular formula C16H20NO4+ and a molecular weight of 290.34 g/mol. Its IUPAC name is 4-[(4-hydroxypiperidin-1-ium-1-yl)methyl]-7-methoxychromen-2-one.
| Compound Name | 4-[(4-hydroxypiperidin-1-ium-1-yl)methyl]-7-methoxychromen-2-one |
|---|---|
| PubChem CID | 9339880 |
| Molecular Formula | C16H20NO4+ |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 4-[(4-hydroxypiperidin-1-ium-1-yl)methyl]-7-methoxychromen-2-one |
| SMILES | COc1ccc2c(C[NH+]3CCC(O)CC3)cc(=O)oc2c1 |
| InChI | InChI=1S/C16H19NO4/c1-20-13-2-3-14-11(8-16(19)21-15(14)9-13)10-17-6-4-12(18)5-7-17/h2-3,8-9,12,18H,4-7,10H2,1H3/p+1 |
| InChIKey | KMLPZIDOMCKJLR-UHFFFAOYSA-O |
| XLogP | 0.34 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|