C17H22NO3+ — CID 8903233
7-methoxy-4-[[(3S)-3-methylpiperidin-1-ium-1-yl]methyl]chromen-2-one (PubChem CID 8903233) has the molecular formula C17H22NO3+ and a molecular weight of 288.37 g/mol. Its IUPAC name is 7-methoxy-4-[[(3S)-3-methylpiperidin-1-ium-1-yl]methyl]chromen-2-one.
| Compound Name | 7-methoxy-4-[[(3S)-3-methylpiperidin-1-ium-1-yl]methyl]chromen-2-one |
|---|---|
| PubChem CID | 8903233 |
| Molecular Formula | C17H22NO3+ |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 7-methoxy-4-[[(3S)-3-methylpiperidin-1-ium-1-yl]methyl]chromen-2-one |
| SMILES | COc1ccc2c(C[NH+]3CCC[C@H](C)C3)cc(=O)oc2c1 |
| InChI | InChI=1S/C17H21NO3/c1-12-4-3-7-18(10-12)11-13-8-17(19)21-16-9-14(20-2)5-6-15(13)16/h5-6,8-9,12H,3-4,7,10-11H2,1-2H3/p+1/t12-/m0/s1 |
| InChIKey | WEEYUESLFRBWJX-LBPRGKRZSA-O |
| XLogP | 1.62 |
| TPSA | 43.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|