C19H21N2O5S2+ — CID 2495784
7-methoxy-4-[(4-thiophen-2-ylsulfonylpiperazin-1-ium-1-yl)methyl]chromen-2-one (PubChem CID 2495784) has the molecular formula C19H21N2O5S2+ and a molecular weight of 421.52 g/mol. Its IUPAC name is 7-methoxy-4-[(4-thiophen-2-ylsulfonylpiperazin-1-ium-1-yl)methyl]chromen-2-one.
| Compound Name | 7-methoxy-4-[(4-thiophen-2-ylsulfonylpiperazin-1-ium-1-yl)methyl]chromen-2-one |
|---|---|
| PubChem CID | 2495784 |
| Molecular Formula | C19H21N2O5S2+ |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | 7-methoxy-4-[(4-thiophen-2-ylsulfonylpiperazin-1-ium-1-yl)methyl]chromen-2-one |
| SMILES | COc1ccc2c(C[NH+]3CCN(S(=O)(=O)c4cccs4)CC3)cc(=O)oc2c1 |
| InChI | InChI=1S/C19H20N2O5S2/c1-25-15-4-5-16-14(11-18(22)26-17(16)12-15)13-20-6-8-21(9-7-20)28(23,24)19-3-2-10-27-19/h2-5,10-12H,6-9,13H2,1H3/p+1 |
| InChIKey | RASHYQHSIIHPSO-UHFFFAOYSA-O |
| XLogP | 0.95 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|