C21H21NO7S2 — CID 55425698
(7-methoxy-2-oxochromen-4-yl)methyl 1-thiophen-2-ylsulfonylpiperidine-3-carboxylate (PubChem CID 55425698) has the molecular formula C21H21NO7S2 and a molecular weight of 463.53 g/mol. Its IUPAC name is (7-methoxy-2-oxochromen-4-yl)methyl 1-thiophen-2-ylsulfonylpiperidine-3-carboxylate.
| Compound Name | (7-methoxy-2-oxochromen-4-yl)methyl 1-thiophen-2-ylsulfonylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 55425698 |
| Molecular Formula | C21H21NO7S2 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.08 |
| IUPAC Name | (7-methoxy-2-oxochromen-4-yl)methyl 1-thiophen-2-ylsulfonylpiperidine-3-carboxylate |
| SMILES | COc1ccc2c(COC(=O)C3CCCN(S(=O)(=O)c4cccs4)C3)cc(=O)oc2c1 |
| InChI | InChI=1S/C21H21NO7S2/c1-27-16-6-7-17-15(10-19(23)29-18(17)11-16)13-28-21(24)14-4-2-8-22(12-14)31(25,26)20-5-3-9-30-20/h3,5-7,9-11,14H,2,4,8,12-13H2,1H3 |
| InChIKey | DQWLGWCQMYYNNA-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|