C18H18N2O4S2 — CID 55425432
(4-cyanophenyl)methyl 1-thiophen-2-ylsulfonylpiperidine-3-carboxylate (PubChem CID 55425432) has the molecular formula C18H18N2O4S2 and a molecular weight of 390.49 g/mol. Its IUPAC name is (4-cyanophenyl)methyl 1-thiophen-2-ylsulfonylpiperidine-3-carboxylate.
| Compound Name | (4-cyanophenyl)methyl 1-thiophen-2-ylsulfonylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 55425432 |
| Molecular Formula | C18H18N2O4S2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | (4-cyanophenyl)methyl 1-thiophen-2-ylsulfonylpiperidine-3-carboxylate |
| SMILES | N#Cc1ccc(COC(=O)C2CCCN(S(=O)(=O)c3cccs3)C2)cc1 |
| InChI | InChI=1S/C18H18N2O4S2/c19-11-14-5-7-15(8-6-14)13-24-18(21)16-3-1-9-20(12-16)26(22,23)17-4-2-10-25-17/h2,4-8,10,16H,1,3,9,12-13H2 |
| InChIKey | IRIOWWAUSMICGN-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |